C34H34N4O4 — CID 166444723
(2S)-2-[[2-[9-[2-[[[(1S)-1-carboxypropyl]amino]methyl]phenyl]-1,10-phenanthrolin-2-yl]phenyl]methylamino]butanoic acid (PubChem CID 166444723) has the molecular formula C34H34N4O4 and a molecular weight of 562.67 g/mol. Its IUPAC name is (2S)-2-[[2-[9-[2-[[[(1S)-1-carboxypropyl]amino]methyl]phenyl]-1,10-phenanthrolin-2-yl]phenyl]methylamino]butanoic acid.
| Compound Name | (2S)-2-[[2-[9-[2-[[[(1S)-1-carboxypropyl]amino]methyl]phenyl]-1,10-phenanthrolin-2-yl]phenyl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 166444723 |
| Molecular Formula | C34H34N4O4 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | (2S)-2-[[2-[9-[2-[[[(1S)-1-carboxypropyl]amino]methyl]phenyl]-1,10-phenanthrolin-2-yl]phenyl]methylamino]butanoic acid |
| SMILES | CC[C@H](NCc1ccccc1-c1ccc2ccc3ccc(-c4ccccc4CN[C@@H](CC)C(=O)O)nc3c2n1)C(=O)O |
| InChI | InChI=1S/C34H34N4O4/c1-3-27(33(39)40)35-19-23-9-5-7-11-25(23)29-17-15-21-13-14-22-16-18-30(38-32(22)31(21)37-29)26-12-8-6-10-24(26)20-36-28(4-2)34(41)42/h5-18,27-28,35-36H,3-4,19-20H2,1-2H3,(H,39,40)(H,41,42)/t27-,28-/m0/s1 |
| InChIKey | IUUFKXDCZDOLJB-NSOVKSMOSA-N |
| XLogP | 6.02 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|