C9H10N2O2S — CID 165441542
2-(2-ethylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid (PubChem CID 165441542) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is 2-(2-ethylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid.
| Compound Name | 2-(2-ethylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid |
|---|---|
| PubChem CID | 165441542 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 2-(2-ethylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid |
| SMILES | CCc1cn2cc(CC(=O)O)nc2s1 |
| InChI | InChI=1S/C9H10N2O2S/c1-2-7-5-11-4-6(3-8(12)13)10-9(11)14-7/h4-5H,2-3H2,1H3,(H,12,13) |
| InChIKey | BJDAPQSUXKGBGV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |