2-(2-ethylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid

C9H10N2O2S — CID 165441542

IUPAC2-(2-ethylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid
SMILESCCc1cn2cc(CC(=O)O)nc2s1
InChIInChI=1S/C9H10N2O2S/c1-2-7-5-11-4-6(3-8(12)13)10-9(11)14-7/h4-5H,2-3H2,1H3,(H,12,13)
InChIKeyBJDAPQSUXKGBGV-UHFFFAOYSA-N
MW210.26 g/mol
LogP1.59
Rot. Bonds3

About 2-(2-ethylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid

2-(2-ethylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid (PubChem CID 165441542) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is 2-(2-ethylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid.

Molecular Properties

Compound Name2-(2-ethylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid
PubChem CID165441542
Molecular FormulaC9H10N2O2S
Molecular Weight210.26 g/mol
Exact Mass210.05
IUPAC Name2-(2-ethylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid
SMILESCCc1cn2cc(CC(=O)O)nc2s1
InChIInChI=1S/C9H10N2O2S/c1-2-7-5-11-4-6(3-8(12)13)10-9(11)14-7/h4-5H,2-3H2,1H3,(H,12,13)
InChIKeyBJDAPQSUXKGBGV-UHFFFAOYSA-N
XLogP1.59
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.26
LogP ≤ 51.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(2-ethylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-ethylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid?
The IUPAC name of 2-(2-ethylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid (CID 165441542) is 2-(2-ethylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid.
What is the SMILES notation for 2-(2-ethylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid?
The canonical SMILES for 2-(2-ethylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid is CCc1cn2cc(CC(=O)O)nc2s1.
What is the InChIKey of 2-(2-ethylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid?
The InChIKey is BJDAPQSUXKGBGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2S/c1-2-7-5-11-4-6(3-8(12)13)10-9(11)14-7/h4-5H,2-3H2,1H3,(H,12,13).
What are the key properties of 2-(2-ethylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid?
2-(2-ethylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid has a molecular weight of 210.26 g/mol, XLogP of 1.59, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid is sourced from PubChem (CID 165441542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).