C9H7F3N2 — CID 165442670
(4,5,7-trifluoro-1H-indol-3-yl)methanamine (PubChem CID 165442670) has the molecular formula C9H7F3N2 and a molecular weight of 200.16 g/mol. Its IUPAC name is (4,5,7-trifluoro-1H-indol-3-yl)methanamine.
| Compound Name | (4,5,7-trifluoro-1H-indol-3-yl)methanamine |
|---|---|
| PubChem CID | 165442670 |
| Molecular Formula | C9H7F3N2 |
| Molecular Weight | 200.16 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | (4,5,7-trifluoro-1H-indol-3-yl)methanamine |
| SMILES | NCc1c[nH]c2c(F)cc(F)c(F)c12 |
| InChI | InChI=1S/C9H7F3N2/c10-5-1-6(11)9-7(8(5)12)4(2-13)3-14-9/h1,3,14H,2,13H2 |
| InChIKey | UVXBPMPOXXANGP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.16 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|