About [4-methyl-5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]methanamine
[4-methyl-5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]methanamine (PubChem CID 165447410) has the molecular formula C8H9N3S2
and a molecular weight of 211.31 g/mol. Its IUPAC name is [4-methyl-5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]methanamine.
Molecular Properties
| Compound Name | [4-methyl-5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]methanamine |
| PubChem CID | 165447410 |
| Molecular Formula | C8H9N3S2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | [4-methyl-5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]methanamine |
| SMILES | Cc1nc(CN)sc1-c1nccs1 |
| InChI | InChI=1S/C8H9N3S2/c1-5-7(8-10-2-3-12-8)13-6(4-9)11-5/h2-3H,4,9H2,1H3 |
| InChIKey | QFGKTGDCDRVFSH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-methyl-5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methyl-5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]methanamine?
The IUPAC name of [4-methyl-5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]methanamine (CID 165447410) is [4-methyl-5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]methanamine.
What is the SMILES notation for [4-methyl-5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]methanamine?
The canonical SMILES for [4-methyl-5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]methanamine is Cc1nc(CN)sc1-c1nccs1.
What is the InChIKey of [4-methyl-5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]methanamine?
The InChIKey is QFGKTGDCDRVFSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3S2/c1-5-7(8-10-2-3-12-8)13-6(4-9)11-5/h2-3H,4,9H2,1H3.
What are the key properties of [4-methyl-5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]methanamine?
[4-methyl-5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]methanamine has a molecular weight of 211.31 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methyl-5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]methanamine is sourced from PubChem (CID 165447410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).