C15H19F2NO2 — CID 165448511
tert-butyl (3S,4R)-4-(3,5-difluorophenyl)pyrrolidine-3-carboxylate (PubChem CID 165448511) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is tert-butyl (3S,4R)-4-(3,5-difluorophenyl)pyrrolidine-3-carboxylate.
| Compound Name | tert-butyl (3S,4R)-4-(3,5-difluorophenyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 165448511 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | tert-butyl (3S,4R)-4-(3,5-difluorophenyl)pyrrolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CNC[C@H]1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H19F2NO2/c1-15(2,3)20-14(19)13-8-18-7-12(13)9-4-10(16)6-11(17)5-9/h4-6,12-13,18H,7-8H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | MPFQRCZYYRXMCR-QWHCGFSZSA-N |
| XLogP | 2.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |