About (1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazine
(1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazine (PubChem CID 165449025) has the molecular formula C10H16N6
and a molecular weight of 220.28 g/mol. Its IUPAC name is (1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazine.
Molecular Properties
| Compound Name | (1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazine |
| PubChem CID | 165449025 |
| Molecular Formula | C10H16N6 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | (1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazine |
| SMILES | CCC(CC)n1ncc2c(NN)ncnc21 |
| InChI | InChI=1S/C10H16N6/c1-3-7(4-2)16-10-8(5-14-16)9(15-11)12-6-13-10/h5-7H,3-4,11H2,1-2H3,(H,12,13,15) |
| InChIKey | MFQMSCWDBKEMJX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazine?
The IUPAC name of (1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazine (CID 165449025) is (1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazine.
What is the SMILES notation for (1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazine?
The canonical SMILES for (1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazine is CCC(CC)n1ncc2c(NN)ncnc21.
What is the InChIKey of (1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazine?
The InChIKey is MFQMSCWDBKEMJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N6/c1-3-7(4-2)16-10-8(5-14-16)9(15-11)12-6-13-10/h5-7H,3-4,11H2,1-2H3,(H,12,13,15).
What are the key properties of (1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazine?
(1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazine has a molecular weight of 220.28 g/mol, XLogP of 1.47, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazine is sourced from PubChem (CID 165449025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).