C10H16N6 — CID 165449025
(1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazine (PubChem CID 165449025) has the molecular formula C10H16N6 and a molecular weight of 220.28 g/mol. Its IUPAC name is (1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazine.
| Compound Name | (1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 165449025 |
| Molecular Formula | C10H16N6 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | (1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazine |
| SMILES | CCC(CC)n1ncc2c(NN)ncnc21 |
| InChI | InChI=1S/C10H16N6/c1-3-7(4-2)16-10-8(5-14-16)9(15-11)12-6-13-10/h5-7H,3-4,11H2,1-2H3,(H,12,13,15) |
| InChIKey | MFQMSCWDBKEMJX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|