C11H13BrO2S2 — CID 165449475
ethyl 5-bromo-3-(thiolan-3-yl)thiophene-2-carboxylate (PubChem CID 165449475) has the molecular formula C11H13BrO2S2 and a molecular weight of 321.26 g/mol. Its IUPAC name is ethyl 5-bromo-3-(thiolan-3-yl)thiophene-2-carboxylate.
| Compound Name | ethyl 5-bromo-3-(thiolan-3-yl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 165449475 |
| Molecular Formula | C11H13BrO2S2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 319.95 |
| IUPAC Name | ethyl 5-bromo-3-(thiolan-3-yl)thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(Br)cc1C1CCSC1 |
| InChI | InChI=1S/C11H13BrO2S2/c1-2-14-11(13)10-8(5-9(12)16-10)7-3-4-15-6-7/h5,7H,2-4,6H2,1H3 |
| InChIKey | XHMHLZQNNQADME-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |