C6H9NaO3S — CID 165450002
sodium (1R,2R,4S)-7-oxabicyclo[2.2.1]heptane-2-sulfinate (PubChem CID 165450002) has the molecular formula C6H9NaO3S and a molecular weight of 184.19 g/mol. Its IUPAC name is sodium (1R,2R,4S)-7-oxabicyclo[2.2.1]heptane-2-sulfinate.
| Compound Name | sodium (1R,2R,4S)-7-oxabicyclo[2.2.1]heptane-2-sulfinate |
|---|---|
| PubChem CID | 165450002 |
| Molecular Formula | C6H9NaO3S |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | sodium (1R,2R,4S)-7-oxabicyclo[2.2.1]heptane-2-sulfinate |
| SMILES | O=S([O-])[C@@H]1C[C@@H]2CC[C@H]1O2.[Na+] |
| InChI | InChI=1S/C6H10O3S.Na/c7-10(8)6-3-4-1-2-5(6)9-4;/h4-6H,1-3H2,(H,7,8);/q;+1/p-1/t4-,5+,6+;/m0./s1 |
| InChIKey | HDGDMPPHQMQFLA-FPKZOZHISA-M |
| XLogP | -2.81 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|