C10H14F2 — CID 165450649
4-(cyclopropylmethylidene)-1,1-difluorocyclohexane (PubChem CID 165450649) has the molecular formula C10H14F2 and a molecular weight of 172.22 g/mol. Its IUPAC name is 4-(cyclopropylmethylidene)-1,1-difluorocyclohexane.
| Compound Name | 4-(cyclopropylmethylidene)-1,1-difluorocyclohexane |
|---|---|
| PubChem CID | 165450649 |
| Molecular Formula | C10H14F2 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 4-(cyclopropylmethylidene)-1,1-difluorocyclohexane |
| SMILES | FC1(F)CCC(=CC2CC2)CC1 |
| InChI | InChI=1S/C10H14F2/c11-10(12)5-3-9(4-6-10)7-8-1-2-8/h7-8H,1-6H2 |
| InChIKey | NNMRYFWFEYEPSK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|