C11H9F3N2S — CID 165451580
2-methyl-5-(1,3-thiazol-2-yl)-3-(trifluoromethyl)aniline (PubChem CID 165451580) has the molecular formula C11H9F3N2S and a molecular weight of 258.27 g/mol. Its IUPAC name is 2-methyl-5-(1,3-thiazol-2-yl)-3-(trifluoromethyl)aniline.
| Compound Name | 2-methyl-5-(1,3-thiazol-2-yl)-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 165451580 |
| Molecular Formula | C11H9F3N2S |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 2-methyl-5-(1,3-thiazol-2-yl)-3-(trifluoromethyl)aniline |
| SMILES | Cc1c(N)cc(-c2nccs2)cc1C(F)(F)F |
| InChI | InChI=1S/C11H9F3N2S/c1-6-8(11(12,13)14)4-7(5-9(6)15)10-16-2-3-17-10/h2-5H,15H2,1H3 |
| InChIKey | WTSBHPVCUOOLCT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|