C8H5BrFNO3S — CID 165453546
6-bromo-2-oxo-1,3-dihydroindole-5-sulfonyl fluoride (PubChem CID 165453546) has the molecular formula C8H5BrFNO3S and a molecular weight of 294.10 g/mol. Its IUPAC name is 6-bromo-2-oxo-1,3-dihydroindole-5-sulfonyl fluoride.
| Compound Name | 6-bromo-2-oxo-1,3-dihydroindole-5-sulfonyl fluoride |
|---|---|
| PubChem CID | 165453546 |
| Molecular Formula | C8H5BrFNO3S |
| Molecular Weight | 294.10 g/mol |
| Exact Mass | 292.92 |
| IUPAC Name | 6-bromo-2-oxo-1,3-dihydroindole-5-sulfonyl fluoride |
| SMILES | O=C1Cc2cc(S(=O)(=O)F)c(Br)cc2N1 |
| InChI | InChI=1S/C8H5BrFNO3S/c9-5-3-6-4(2-8(12)11-6)1-7(5)15(10,13)14/h1,3H,2H2,(H,11,12) |
| InChIKey | ODAKOPQVBCNCKG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.10 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |