C11H13ClO3S — CID 165453775
5-chloro-2-(2-cyclopropylethoxy)benzenesulfinic acid (PubChem CID 165453775) has the molecular formula C11H13ClO3S and a molecular weight of 260.74 g/mol. Its IUPAC name is 5-chloro-2-(2-cyclopropylethoxy)benzenesulfinic acid.
| Compound Name | 5-chloro-2-(2-cyclopropylethoxy)benzenesulfinic acid |
|---|---|
| PubChem CID | 165453775 |
| Molecular Formula | C11H13ClO3S |
| Molecular Weight | 260.74 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 5-chloro-2-(2-cyclopropylethoxy)benzenesulfinic acid |
| SMILES | O=S(O)c1cc(Cl)ccc1OCCC1CC1 |
| InChI | InChI=1S/C11H13ClO3S/c12-9-3-4-10(11(7-9)16(13)14)15-6-5-8-1-2-8/h3-4,7-8H,1-2,5-6H2,(H,13,14) |
| InChIKey | TXGVUQWWCOJBRO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.74 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|