C15H21ClN2O5S — CID 167930626
3-[[5-chloro-2-(2-cyclopropylethoxy)phenyl]sulfonylamino]-2-hydroxy-N-methylpropanamide (PubChem CID 167930626) has the molecular formula C15H21ClN2O5S and a molecular weight of 376.86 g/mol. Its IUPAC name is 3-[[5-chloro-2-(2-cyclopropylethoxy)phenyl]sulfonylamino]-2-hydroxy-N-methylpropanamide.
| Compound Name | 3-[[5-chloro-2-(2-cyclopropylethoxy)phenyl]sulfonylamino]-2-hydroxy-N-methylpropanamide |
|---|---|
| PubChem CID | 167930626 |
| Molecular Formula | C15H21ClN2O5S |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 3-[[5-chloro-2-(2-cyclopropylethoxy)phenyl]sulfonylamino]-2-hydroxy-N-methylpropanamide |
| SMILES | CNC(=O)C(O)CNS(=O)(=O)c1cc(Cl)ccc1OCCC1CC1 |
| InChI | InChI=1S/C15H21ClN2O5S/c1-17-15(20)12(19)9-18-24(21,22)14-8-11(16)4-5-13(14)23-7-6-10-2-3-10/h4-5,8,10,12,18-19H,2-3,6-7,9H2,1H3,(H,17,20) |
| InChIKey | JUNKJMCANXXPGI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |