C17H13N3O4 — CID 16545567
(E)-1-(3-nitrophenyl)-N-[(2-phenyl-1,3-oxazol-4-yl)methoxy]methanimine (PubChem CID 16545567) has the molecular formula C17H13N3O4 and a molecular weight of 323.31 g/mol. Its IUPAC name is (E)-1-(3-nitrophenyl)-N-[(2-phenyl-1,3-oxazol-4-yl)methoxy]methanimine.
| Compound Name | (E)-1-(3-nitrophenyl)-N-[(2-phenyl-1,3-oxazol-4-yl)methoxy]methanimine |
|---|---|
| PubChem CID | 16545567 |
| Molecular Formula | C17H13N3O4 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | (E)-1-(3-nitrophenyl)-N-[(2-phenyl-1,3-oxazol-4-yl)methoxy]methanimine |
| SMILES | O=[N+]([O-])c1cccc(/C=N/OCc2coc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C17H13N3O4/c21-20(22)16-8-4-5-13(9-16)10-18-24-12-15-11-23-17(19-15)14-6-2-1-3-7-14/h1-11H,12H2/b18-10+ |
| InChIKey | MKSBOHBPIDJUQF-VCHYOVAHSA-N |
| XLogP | 3.80 |
| TPSA | 90.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|