C10H8BrF4NO2 — CID 165455689
6-[bromo(difluoro)methyl]-2-(difluoromethyl)-4,5-dimethylpyridine-3-carboxylic acid (PubChem CID 165455689) has the molecular formula C10H8BrF4NO2 and a molecular weight of 330.08 g/mol. Its IUPAC name is 6-[bromo(difluoro)methyl]-2-(difluoromethyl)-4,5-dimethylpyridine-3-carboxylic acid.
| Compound Name | 6-[bromo(difluoro)methyl]-2-(difluoromethyl)-4,5-dimethylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 165455689 |
| Molecular Formula | C10H8BrF4NO2 |
| Molecular Weight | 330.08 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | 6-[bromo(difluoro)methyl]-2-(difluoromethyl)-4,5-dimethylpyridine-3-carboxylic acid |
| SMILES | Cc1c(C(F)(F)Br)nc(C(F)F)c(C(=O)O)c1C |
| InChI | InChI=1S/C10H8BrF4NO2/c1-3-4(2)7(10(11,14)15)16-6(8(12)13)5(3)9(17)18/h8H,1-2H3,(H,17,18) |
| InChIKey | NOAIYWYNGXZIGU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.08 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|