C9H5Cl2F4NO2 — CID 165455753
2,6-bis[chloro(difluoro)methyl]-4-methylpyridine-3-carboxylic acid (PubChem CID 165455753) has the molecular formula C9H5Cl2F4NO2 and a molecular weight of 306.04 g/mol. Its IUPAC name is 2,6-bis[chloro(difluoro)methyl]-4-methylpyridine-3-carboxylic acid.
| Compound Name | 2,6-bis[chloro(difluoro)methyl]-4-methylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 165455753 |
| Molecular Formula | C9H5Cl2F4NO2 |
| Molecular Weight | 306.04 g/mol |
| Exact Mass | 304.96 |
| IUPAC Name | 2,6-bis[chloro(difluoro)methyl]-4-methylpyridine-3-carboxylic acid |
| SMILES | Cc1cc(C(F)(F)Cl)nc(C(F)(F)Cl)c1C(=O)O |
| InChI | InChI=1S/C9H5Cl2F4NO2/c1-3-2-4(8(10,12)13)16-6(9(11,14)15)5(3)7(17)18/h2H,1H3,(H,17,18) |
| InChIKey | DZYJEDOCGNWCTB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.04 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|