C11H12ClF2NO2 — CID 165455754
6-[chloro(difluoro)methyl]-4-methyl-2-propan-2-ylpyridine-3-carboxylic acid (PubChem CID 165455754) has the molecular formula C11H12ClF2NO2 and a molecular weight of 263.67 g/mol. Its IUPAC name is 6-[chloro(difluoro)methyl]-4-methyl-2-propan-2-ylpyridine-3-carboxylic acid.
| Compound Name | 6-[chloro(difluoro)methyl]-4-methyl-2-propan-2-ylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 165455754 |
| Molecular Formula | C11H12ClF2NO2 |
| Molecular Weight | 263.67 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 6-[chloro(difluoro)methyl]-4-methyl-2-propan-2-ylpyridine-3-carboxylic acid |
| SMILES | Cc1cc(C(F)(F)Cl)nc(C(C)C)c1C(=O)O |
| InChI | InChI=1S/C11H12ClF2NO2/c1-5(2)9-8(10(16)17)6(3)4-7(15-9)11(12,13)14/h4-5H,1-3H3,(H,16,17) |
| InChIKey | WZQNGJDOWSMPSW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.67 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|