C15H14FNO — CID 165456739
4-(5-amino-2-fluorophenyl)-2,5-dimethylbenzaldehyde (PubChem CID 165456739) has the molecular formula C15H14FNO and a molecular weight of 243.28 g/mol. Its IUPAC name is 4-(5-amino-2-fluorophenyl)-2,5-dimethylbenzaldehyde.
| Compound Name | 4-(5-amino-2-fluorophenyl)-2,5-dimethylbenzaldehyde |
|---|---|
| PubChem CID | 165456739 |
| Molecular Formula | C15H14FNO |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 4-(5-amino-2-fluorophenyl)-2,5-dimethylbenzaldehyde |
| SMILES | Cc1cc(-c2cc(N)ccc2F)c(C)cc1C=O |
| InChI | InChI=1S/C15H14FNO/c1-9-6-13(10(2)5-11(9)8-18)14-7-12(17)3-4-15(14)16/h3-8H,17H2,1-2H3 |
| InChIKey | OTQUNTKREFOGFA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|