C16H22ClFN2O2 — CID 165457824
tert-butyl 4-amino-2-(2-chloro-4-fluorophenyl)piperidine-1-carboxylate (PubChem CID 165457824) has the molecular formula C16H22ClFN2O2 and a molecular weight of 328.82 g/mol. Its IUPAC name is tert-butyl 4-amino-2-(2-chloro-4-fluorophenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-amino-2-(2-chloro-4-fluorophenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 165457824 |
| Molecular Formula | C16H22ClFN2O2 |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | tert-butyl 4-amino-2-(2-chloro-4-fluorophenyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N)CC1c1ccc(F)cc1Cl |
| InChI | InChI=1S/C16H22ClFN2O2/c1-16(2,3)22-15(21)20-7-6-11(19)9-14(20)12-5-4-10(18)8-13(12)17/h4-5,8,11,14H,6-7,9,19H2,1-3H3 |
| InChIKey | PRQDPCJCAZGPST-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |