C19H26ClNO3 — CID 176939974
tert-butyl 2-[2-chloro-4-(1-methoxyethenyl)phenyl]piperidine-1-carboxylate (PubChem CID 176939974) has the molecular formula C19H26ClNO3 and a molecular weight of 351.87 g/mol. Its IUPAC name is tert-butyl 2-[2-chloro-4-(1-methoxyethenyl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-chloro-4-(1-methoxyethenyl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 176939974 |
| Molecular Formula | C19H26ClNO3 |
| Molecular Weight | 351.87 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | tert-butyl 2-[2-chloro-4-(1-methoxyethenyl)phenyl]piperidine-1-carboxylate |
| SMILES | C=C(OC)c1ccc(C2CCCCN2C(=O)OC(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C19H26ClNO3/c1-13(23-5)14-9-10-15(16(20)12-14)17-8-6-7-11-21(17)18(22)24-19(2,3)4/h9-10,12,17H,1,6-8,11H2,2-5H3 |
| InChIKey | KIIPUWFGBTXKKX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.87 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|