C18H27ClNO4P — CID 146193694
tert-butyl 3-(2-chloro-4-dimethylphosphorylphenyl)-1,4-oxazepane-4-carboxylate (PubChem CID 146193694) has the molecular formula C18H27ClNO4P and a molecular weight of 387.84 g/mol. Its IUPAC name is tert-butyl 3-(2-chloro-4-dimethylphosphorylphenyl)-1,4-oxazepane-4-carboxylate.
| Compound Name | tert-butyl 3-(2-chloro-4-dimethylphosphorylphenyl)-1,4-oxazepane-4-carboxylate |
|---|---|
| PubChem CID | 146193694 |
| Molecular Formula | C18H27ClNO4P |
| Molecular Weight | 387.84 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | tert-butyl 3-(2-chloro-4-dimethylphosphorylphenyl)-1,4-oxazepane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCOCC1c1ccc(P(C)(C)=O)cc1Cl |
| InChI | InChI=1S/C18H27ClNO4P/c1-18(2,3)24-17(21)20-9-6-10-23-12-16(20)14-8-7-13(11-15(14)19)25(4,5)22/h7-8,11,16H,6,9-10,12H2,1-5H3 |
| InChIKey | XXCNSBURIVYEKO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.84 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|