C18H25ClN2O4 — CID 175704250
tert-butyl (3R)-3-(5-acetamido-2-chlorophenyl)-1,4-oxazepane-4-carboxylate (PubChem CID 175704250) has the molecular formula C18H25ClN2O4 and a molecular weight of 368.86 g/mol. Its IUPAC name is tert-butyl (3R)-3-(5-acetamido-2-chlorophenyl)-1,4-oxazepane-4-carboxylate.
| Compound Name | tert-butyl (3R)-3-(5-acetamido-2-chlorophenyl)-1,4-oxazepane-4-carboxylate |
|---|---|
| PubChem CID | 175704250 |
| Molecular Formula | C18H25ClN2O4 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | tert-butyl (3R)-3-(5-acetamido-2-chlorophenyl)-1,4-oxazepane-4-carboxylate |
| SMILES | CC(=O)Nc1ccc(Cl)c([C@@H]2COCCCN2C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C18H25ClN2O4/c1-12(22)20-13-6-7-15(19)14(10-13)16-11-24-9-5-8-21(16)17(23)25-18(2,3)4/h6-7,10,16H,5,8-9,11H2,1-4H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | PZNHAXWJPWDNRI-INIZCTEOSA-N |
| XLogP | 4.00 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |