C7H11ClO3S — CID 165459173
[(3aR,6aR)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-yl]methanesulfinyl chloride (PubChem CID 165459173) has the molecular formula C7H11ClO3S and a molecular weight of 210.68 g/mol. Its IUPAC name is [(3aR,6aR)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-yl]methanesulfinyl chloride.
| Compound Name | [(3aR,6aR)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-yl]methanesulfinyl chloride |
|---|---|
| PubChem CID | 165459173 |
| Molecular Formula | C7H11ClO3S |
| Molecular Weight | 210.68 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | [(3aR,6aR)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-yl]methanesulfinyl chloride |
| SMILES | O=S(Cl)CC1C[C@@H]2COC[C@@H]2O1 |
| InChI | InChI=1S/C7H11ClO3S/c8-12(9)4-6-1-5-2-10-3-7(5)11-6/h5-7H,1-4H2/t5-,6?,7+,12?/m1/s1 |
| InChIKey | KZVHYUQMOWIRMW-JUYFMSGGSA-N |
| XLogP | 0.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.68 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |