C7H13NO3S — CID 165459175
[(2S,3aS,6aR)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-yl]methanesulfinamide (PubChem CID 165459175) has the molecular formula C7H13NO3S and a molecular weight of 191.25 g/mol. Its IUPAC name is [(2S,3aS,6aR)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-yl]methanesulfinamide.
| Compound Name | [(2S,3aS,6aR)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-yl]methanesulfinamide |
|---|---|
| PubChem CID | 165459175 |
| Molecular Formula | C7H13NO3S |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | [(2S,3aS,6aR)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-yl]methanesulfinamide |
| SMILES | NS(=O)C[C@@H]1C[C@H]2COC[C@@H]2O1 |
| InChI | InChI=1S/C7H13NO3S/c8-12(9)4-6-1-5-2-10-3-7(5)11-6/h5-7H,1-4,8H2/t5-,6-,7-,12?/m0/s1 |
| InChIKey | CALYQBOEDUJNIY-SYTOZWEMSA-N |
| XLogP | -0.59 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |