4-(3-chlorophenoxy)benzenesulfonyl fluoride

C12H8ClFO3S — CID 165459698

IUPAC4-(3-chlorophenoxy)benzenesulfonyl fluoride
SMILESO=S(=O)(F)c1ccc(Oc2cccc(Cl)c2)cc1
InChIInChI=1S/C12H8ClFO3S/c13-9-2-1-3-11(8-9)17-10-4-6-12(7-5-10)18(14,15)16/h1-8H
InChIKeyNXBAJGUBNWHETI-UHFFFAOYSA-N
MW286.71 g/mol
LogP3.79
Rot. Bonds3

About 4-(3-chlorophenoxy)benzenesulfonyl fluoride

4-(3-chlorophenoxy)benzenesulfonyl fluoride (PubChem CID 165459698) has the molecular formula C12H8ClFO3S and a molecular weight of 286.71 g/mol. Its IUPAC name is 4-(3-chlorophenoxy)benzenesulfonyl fluoride.

Molecular Properties

Compound Name4-(3-chlorophenoxy)benzenesulfonyl fluoride
PubChem CID165459698
Molecular FormulaC12H8ClFO3S
Molecular Weight286.71 g/mol
Exact Mass285.99
IUPAC Name4-(3-chlorophenoxy)benzenesulfonyl fluoride
SMILESO=S(=O)(F)c1ccc(Oc2cccc(Cl)c2)cc1
InChIInChI=1S/C12H8ClFO3S/c13-9-2-1-3-11(8-9)17-10-4-6-12(7-5-10)18(14,15)16/h1-8H
InChIKeyNXBAJGUBNWHETI-UHFFFAOYSA-N
XLogP3.79
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.71
LogP ≤ 53.79
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 4-(3-chlorophenoxy)benzenesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3-chlorophenoxy)benzenesulfonyl fluoride?
The IUPAC name of 4-(3-chlorophenoxy)benzenesulfonyl fluoride (CID 165459698) is 4-(3-chlorophenoxy)benzenesulfonyl fluoride.
What is the SMILES notation for 4-(3-chlorophenoxy)benzenesulfonyl fluoride?
The canonical SMILES for 4-(3-chlorophenoxy)benzenesulfonyl fluoride is O=S(=O)(F)c1ccc(Oc2cccc(Cl)c2)cc1.
What is the InChIKey of 4-(3-chlorophenoxy)benzenesulfonyl fluoride?
The InChIKey is NXBAJGUBNWHETI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8ClFO3S/c13-9-2-1-3-11(8-9)17-10-4-6-12(7-5-10)18(14,15)16/h1-8H.
What are the key properties of 4-(3-chlorophenoxy)benzenesulfonyl fluoride?
4-(3-chlorophenoxy)benzenesulfonyl fluoride has a molecular weight of 286.71 g/mol, XLogP of 3.79, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chlorophenoxy)benzenesulfonyl fluoride is sourced from PubChem (CID 165459698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).