C27H34N2O6 — CID 165460320
4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-methoxypentanoyl]amino]-3,3-dimethylbutanoic acid (PubChem CID 165460320) has the molecular formula C27H34N2O6 and a molecular weight of 482.58 g/mol. Its IUPAC name is 4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-methoxypentanoyl]amino]-3,3-dimethylbutanoic acid.
| Compound Name | 4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-methoxypentanoyl]amino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 165460320 |
| Molecular Formula | C27H34N2O6 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-methoxypentanoyl]amino]-3,3-dimethylbutanoic acid |
| SMILES | COCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCC(C)(C)CC(=O)O |
| InChI | InChI=1S/C27H34N2O6/c1-27(2,15-24(30)31)17-28-25(32)23(13-8-14-34-3)29-26(33)35-16-22-20-11-6-4-9-18(20)19-10-5-7-12-21(19)22/h4-7,9-12,22-23H,8,13-17H2,1-3H3,(H,28,32)(H,29,33)(H,30,31) |
| InChIKey | VNAVHGALKRCOLJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|