C24H29N3O5 — CID 91058630
9H-fluoren-9-ylmethyl N-[4-(3-methoxypropylamino)-1-(methylamino)-1,4-dioxobutan-2-yl]carbamate (PubChem CID 91058630) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(3-methoxypropylamino)-1-(methylamino)-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(3-methoxypropylamino)-1-(methylamino)-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 91058630 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(3-methoxypropylamino)-1-(methylamino)-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CNC(=O)C(CC(=O)NCCCOC)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H29N3O5/c1-25-23(29)21(14-22(28)26-12-7-13-31-2)27-24(30)32-15-20-18-10-5-3-8-16(18)17-9-4-6-11-19(17)20/h3-6,8-11,20-21H,7,12-15H2,1-2H3,(H,25,29)(H,26,28)(H,27,30) |
| InChIKey | ASRLZVVNHAYYEY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|