C8H4F2N2O2S — CID 165461498
4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]thiophene-2-carbaldehyde (PubChem CID 165461498) has the molecular formula C8H4F2N2O2S and a molecular weight of 230.19 g/mol. Its IUPAC name is 4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]thiophene-2-carbaldehyde.
| Compound Name | 4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 165461498 |
| Molecular Formula | C8H4F2N2O2S |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | 4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]thiophene-2-carbaldehyde |
| SMILES | O=Cc1cc(-c2nnc(C(F)F)o2)cs1 |
| InChI | InChI=1S/C8H4F2N2O2S/c9-6(10)8-12-11-7(14-8)4-1-5(2-13)15-3-4/h1-3,6H |
| InChIKey | ONUOLUNUBUPXHL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|