C7H10Cl3N3 — CID 165462427
N-[[2-(trichloromethyl)-1H-imidazol-5-yl]methyl]ethanamine (PubChem CID 165462427) has the molecular formula C7H10Cl3N3 and a molecular weight of 242.54 g/mol. Its IUPAC name is N-[[2-(trichloromethyl)-1H-imidazol-5-yl]methyl]ethanamine.
| Compound Name | N-[[2-(trichloromethyl)-1H-imidazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 165462427 |
| Molecular Formula | C7H10Cl3N3 |
| Molecular Weight | 242.54 g/mol |
| Exact Mass | 240.99 |
| IUPAC Name | N-[[2-(trichloromethyl)-1H-imidazol-5-yl]methyl]ethanamine |
| SMILES | CCNCc1cnc(C(Cl)(Cl)Cl)[nH]1 |
| InChI | InChI=1S/C7H10Cl3N3/c1-2-11-3-5-4-12-6(13-5)7(8,9)10/h4,11H,2-3H2,1H3,(H,12,13) |
| InChIKey | DSANXKOUDDVOFJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.54 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|