About 2-methyl-3,9-dioxa-12-azadispiro[4.0.56.35]tetradecan-13-one
2-methyl-3,9-dioxa-12-azadispiro[4.0.56.35]tetradecan-13-one (PubChem CID 165462683) has the molecular formula C12H19NO3
and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-methyl-3,9-dioxa-12-azadispiro[4.0.56.35]tetradecan-13-one.
Analyze 2-methyl-3,9-dioxa-12-azadispiro[4.0.56.35]tetradecan-13-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,9-dioxa-12-azadispiro[4.0.56.35]tetradecan-13-one?
The IUPAC name of 2-methyl-3,9-dioxa-12-azadispiro[4.0.56.35]tetradecan-13-one (CID 165462683) is 2-methyl-3,9-dioxa-12-azadispiro[4.0.56.35]tetradecan-13-one.
What is the SMILES notation for 2-methyl-3,9-dioxa-12-azadispiro[4.0.56.35]tetradecan-13-one?
The canonical SMILES for 2-methyl-3,9-dioxa-12-azadispiro[4.0.56.35]tetradecan-13-one is CC1CC2(CO1)CC(=O)NC21CCOCC1.
What is the InChIKey of 2-methyl-3,9-dioxa-12-azadispiro[4.0.56.35]tetradecan-13-one?
The InChIKey is OHDAJIWNHFKHJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO3/c1-9-6-11(8-16-9)7-10(14)13-12(11)2-4-15-5-3-12/h9H,2-8H2,1H3,(H,13,14).
What are the key properties of 2-methyl-3,9-dioxa-12-azadispiro[4.0.56.35]tetradecan-13-one?
2-methyl-3,9-dioxa-12-azadispiro[4.0.56.35]tetradecan-13-one has a molecular weight of 225.29 g/mol, XLogP of 0.85, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,9-dioxa-12-azadispiro[4.0.56.35]tetradecan-13-one is sourced from PubChem (CID 165462683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).