C12H23N3 — CID 165464224
8-cyclopropyl-1-methyl-1,8-diazaspiro[4.5]decan-4-amine (PubChem CID 165464224) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 8-cyclopropyl-1-methyl-1,8-diazaspiro[4.5]decan-4-amine.
| Compound Name | 8-cyclopropyl-1-methyl-1,8-diazaspiro[4.5]decan-4-amine |
|---|---|
| PubChem CID | 165464224 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 8-cyclopropyl-1-methyl-1,8-diazaspiro[4.5]decan-4-amine |
| SMILES | CN1CCC(N)C12CCN(C1CC1)CC2 |
| InChI | InChI=1S/C12H23N3/c1-14-7-4-11(13)12(14)5-8-15(9-6-12)10-2-3-10/h10-11H,2-9,13H2,1H3 |
| InChIKey | UPTCERZSSGXTEY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |