C14H21NO3 — CID 165465502
tert-butyl N-(2-cyclopropyl-4-oxohex-5-ynyl)carbamate (PubChem CID 165465502) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is tert-butyl N-(2-cyclopropyl-4-oxohex-5-ynyl)carbamate.
| Compound Name | tert-butyl N-(2-cyclopropyl-4-oxohex-5-ynyl)carbamate |
|---|---|
| PubChem CID | 165465502 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | tert-butyl N-(2-cyclopropyl-4-oxohex-5-ynyl)carbamate |
| SMILES | C#CC(=O)CC(CNC(=O)OC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C14H21NO3/c1-5-12(16)8-11(10-6-7-10)9-15-13(17)18-14(2,3)4/h1,10-11H,6-9H2,2-4H3,(H,15,17) |
| InChIKey | IYJUOWCTCQGAMC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|