C7H9ClN2O4S — CID 165466217
2-chloro-N-methyl-5-(methylsulfamoyl)furan-3-carboxamide (PubChem CID 165466217) has the molecular formula C7H9ClN2O4S and a molecular weight of 252.68 g/mol. Its IUPAC name is 2-chloro-N-methyl-5-(methylsulfamoyl)furan-3-carboxamide.
| Compound Name | 2-chloro-N-methyl-5-(methylsulfamoyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 165466217 |
| Molecular Formula | C7H9ClN2O4S |
| Molecular Weight | 252.68 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 2-chloro-N-methyl-5-(methylsulfamoyl)furan-3-carboxamide |
| SMILES | CNC(=O)c1cc(S(=O)(=O)NC)oc1Cl |
| InChI | InChI=1S/C7H9ClN2O4S/c1-9-7(11)4-3-5(14-6(4)8)15(12,13)10-2/h3,10H,1-2H3,(H,9,11) |
| InChIKey | ZTGBEGQITVHFJI-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.68 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |