C13H21NO2 — CID 165466547
tert-butyl 3-(5,5-dimethylpyrrolidin-2-yl)prop-2-ynoate (PubChem CID 165466547) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is tert-butyl 3-(5,5-dimethylpyrrolidin-2-yl)prop-2-ynoate.
| Compound Name | tert-butyl 3-(5,5-dimethylpyrrolidin-2-yl)prop-2-ynoate |
|---|---|
| PubChem CID | 165466547 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | tert-butyl 3-(5,5-dimethylpyrrolidin-2-yl)prop-2-ynoate |
| SMILES | CC1(C)CCC(C#CC(=O)OC(C)(C)C)N1 |
| InChI | InChI=1S/C13H21NO2/c1-12(2,3)16-11(15)7-6-10-8-9-13(4,5)14-10/h10,14H,8-9H2,1-5H3 |
| InChIKey | BNNJRSSTZWMKNI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|