C10H9IN2S2 — CID 165470258
4-(5-iodo-1,3-thiazol-2-yl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine (PubChem CID 165470258) has the molecular formula C10H9IN2S2 and a molecular weight of 348.23 g/mol. Its IUPAC name is 4-(5-iodo-1,3-thiazol-2-yl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine.
| Compound Name | 4-(5-iodo-1,3-thiazol-2-yl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 165470258 |
| Molecular Formula | C10H9IN2S2 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.93 |
| IUPAC Name | 4-(5-iodo-1,3-thiazol-2-yl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine |
| SMILES | Ic1cnc(C2NCCc3sccc32)s1 |
| InChI | InChI=1S/C10H9IN2S2/c11-8-5-13-10(15-8)9-6-2-4-14-7(6)1-3-12-9/h2,4-5,9,12H,1,3H2 |
| InChIKey | XFNIDNDHKIYDFV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|