C13H17NS — CID 165470262
4-cyclohex-3-en-1-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine (PubChem CID 165470262) has the molecular formula C13H17NS and a molecular weight of 219.35 g/mol. Its IUPAC name is 4-cyclohex-3-en-1-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine.
| Compound Name | 4-cyclohex-3-en-1-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 165470262 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 4-cyclohex-3-en-1-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine |
| SMILES | C1=CCC(C2NCCc3sccc32)CC1 |
| InChI | InChI=1S/C13H17NS/c1-2-4-10(5-3-1)13-11-7-9-15-12(11)6-8-14-13/h1-2,7,9-10,13-14H,3-6,8H2 |
| InChIKey | DOGOLIHVXNPAPJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|