C5H6F2N2O — CID 165473044
2,2-difluoro-1-(1H-pyrazol-4-yl)ethanol (PubChem CID 165473044) has the molecular formula C5H6F2N2O and a molecular weight of 148.11 g/mol. Its IUPAC name is 2,2-difluoro-1-(1H-pyrazol-4-yl)ethanol.
| Compound Name | 2,2-difluoro-1-(1H-pyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 165473044 |
| Molecular Formula | C5H6F2N2O |
| Molecular Weight | 148.11 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | 2,2-difluoro-1-(1H-pyrazol-4-yl)ethanol |
| SMILES | OC(c1cn[nH]c1)C(F)F |
| InChI | InChI=1S/C5H6F2N2O/c6-5(7)4(10)3-1-8-9-2-3/h1-2,4-5,10H,(H,8,9) |
| InChIKey | NGKDQLYUXNQMSF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.11 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |