C8H10O2S2 — CID 165473233
methyl 5-methyl-4-(sulfanylmethyl)thiophene-2-carboxylate (PubChem CID 165473233) has the molecular formula C8H10O2S2 and a molecular weight of 202.30 g/mol. Its IUPAC name is methyl 5-methyl-4-(sulfanylmethyl)thiophene-2-carboxylate.
| Compound Name | methyl 5-methyl-4-(sulfanylmethyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 165473233 |
| Molecular Formula | C8H10O2S2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | methyl 5-methyl-4-(sulfanylmethyl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(CS)c(C)s1 |
| InChI | InChI=1S/C8H10O2S2/c1-5-6(4-11)3-7(12-5)8(9)10-2/h3,11H,4H2,1-2H3 |
| InChIKey | RUXCISAKXYJMMU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|