C13H21N5 — CID 165474174
N-(2-azabicyclo[4.1.0]heptan-1-ylmethyl)-2-(azetidin-3-yl)pyrazol-3-amine (PubChem CID 165474174) has the molecular formula C13H21N5 and a molecular weight of 247.35 g/mol. Its IUPAC name is N-(2-azabicyclo[4.1.0]heptan-1-ylmethyl)-2-(azetidin-3-yl)pyrazol-3-amine.
| Compound Name | N-(2-azabicyclo[4.1.0]heptan-1-ylmethyl)-2-(azetidin-3-yl)pyrazol-3-amine |
|---|---|
| PubChem CID | 165474174 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | N-(2-azabicyclo[4.1.0]heptan-1-ylmethyl)-2-(azetidin-3-yl)pyrazol-3-amine |
| SMILES | c1cc(NCC23CC2CCCN3)n(C2CNC2)n1 |
| InChI | InChI=1S/C13H21N5/c1-2-10-6-13(10,16-4-1)9-15-12-3-5-17-18(12)11-7-14-8-11/h3,5,10-11,14-16H,1-2,4,6-9H2 |
| InChIKey | CUBFMPGLPBGSBC-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 53.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |