C7H8N4O3 — CID 165474356
1-(2-methyltetrazol-5-yl)pentane-1,3,4-trione (PubChem CID 165474356) has the molecular formula C7H8N4O3 and a molecular weight of 196.17 g/mol. Its IUPAC name is 1-(2-methyltetrazol-5-yl)pentane-1,3,4-trione.
| Compound Name | 1-(2-methyltetrazol-5-yl)pentane-1,3,4-trione |
|---|---|
| PubChem CID | 165474356 |
| Molecular Formula | C7H8N4O3 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 1-(2-methyltetrazol-5-yl)pentane-1,3,4-trione |
| SMILES | CC(=O)C(=O)CC(=O)c1nnn(C)n1 |
| InChI | InChI=1S/C7H8N4O3/c1-4(12)5(13)3-6(14)7-8-10-11(2)9-7/h3H2,1-2H3 |
| InChIKey | DMXCKHXFFXOBLN-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 94.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|