C9H14N4O2 — CID 165483878
4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentane-1,3-dione (PubChem CID 165483878) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentane-1,3-dione.
| Compound Name | 4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentane-1,3-dione |
|---|---|
| PubChem CID | 165483878 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentane-1,3-dione |
| SMILES | Cn1nnc(C(=O)CC(=O)C(C)(C)C)n1 |
| InChI | InChI=1S/C9H14N4O2/c1-9(2,3)7(15)5-6(14)8-10-12-13(4)11-8/h5H2,1-4H3 |
| InChIKey | VHYMGHUJEFXOBA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|