C9H10ClN3O2 — CID 165474388
1-(1-chlorocyclopropyl)-3-(2-methyltriazol-4-yl)propane-1,3-dione (PubChem CID 165474388) has the molecular formula C9H10ClN3O2 and a molecular weight of 227.65 g/mol. Its IUPAC name is 1-(1-chlorocyclopropyl)-3-(2-methyltriazol-4-yl)propane-1,3-dione.
| Compound Name | 1-(1-chlorocyclopropyl)-3-(2-methyltriazol-4-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 165474388 |
| Molecular Formula | C9H10ClN3O2 |
| Molecular Weight | 227.65 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 1-(1-chlorocyclopropyl)-3-(2-methyltriazol-4-yl)propane-1,3-dione |
| SMILES | Cn1ncc(C(=O)CC(=O)C2(Cl)CC2)n1 |
| InChI | InChI=1S/C9H10ClN3O2/c1-13-11-5-6(12-13)7(14)4-8(15)9(10)2-3-9/h5H,2-4H2,1H3 |
| InChIKey | DIKCWBVKLSCWAT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.65 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|