C12H10F2O5 — CID 165476656
2-(difluoromethyl)-3,4-dihydro-2H-chromene-3,6-dicarboxylic acid (PubChem CID 165476656) has the molecular formula C12H10F2O5 and a molecular weight of 272.20 g/mol. Its IUPAC name is 2-(difluoromethyl)-3,4-dihydro-2H-chromene-3,6-dicarboxylic acid.
| Compound Name | 2-(difluoromethyl)-3,4-dihydro-2H-chromene-3,6-dicarboxylic acid |
|---|---|
| PubChem CID | 165476656 |
| Molecular Formula | C12H10F2O5 |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 2-(difluoromethyl)-3,4-dihydro-2H-chromene-3,6-dicarboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)CC(C(=O)O)C(C(F)F)O2 |
| InChI | InChI=1S/C12H10F2O5/c13-10(14)9-7(12(17)18)4-6-3-5(11(15)16)1-2-8(6)19-9/h1-3,7,9-10H,4H2,(H,15,16)(H,17,18) |
| InChIKey | NEYAAEAZSITLHU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |