C9H14ClN3 — CID 165479395
4-chloro-1-(4-methylpent-3-enyl)pyrazol-3-amine (PubChem CID 165479395) has the molecular formula C9H14ClN3 and a molecular weight of 199.69 g/mol. Its IUPAC name is 4-chloro-1-(4-methylpent-3-enyl)pyrazol-3-amine.
| Compound Name | 4-chloro-1-(4-methylpent-3-enyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 165479395 |
| Molecular Formula | C9H14ClN3 |
| Molecular Weight | 199.69 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 4-chloro-1-(4-methylpent-3-enyl)pyrazol-3-amine |
| SMILES | CC(C)=CCCn1cc(Cl)c(N)n1 |
| InChI | InChI=1S/C9H14ClN3/c1-7(2)4-3-5-13-6-8(10)9(11)12-13/h4,6H,3,5H2,1-2H3,(H2,11,12) |
| InChIKey | HYHZESWUDOONMU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.69 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|