C9H8BrFN4 — CID 165479866
1-[(4-bromo-3-fluorophenyl)methyl]-1,2,4-triazol-3-amine (PubChem CID 165479866) has the molecular formula C9H8BrFN4 and a molecular weight of 271.09 g/mol. Its IUPAC name is 1-[(4-bromo-3-fluorophenyl)methyl]-1,2,4-triazol-3-amine.
| Compound Name | 1-[(4-bromo-3-fluorophenyl)methyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 165479866 |
| Molecular Formula | C9H8BrFN4 |
| Molecular Weight | 271.09 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 1-[(4-bromo-3-fluorophenyl)methyl]-1,2,4-triazol-3-amine |
| SMILES | Nc1ncn(Cc2ccc(Br)c(F)c2)n1 |
| InChI | InChI=1S/C9H8BrFN4/c10-7-2-1-6(3-8(7)11)4-15-5-13-9(12)14-15/h1-3,5H,4H2,(H2,12,14) |
| InChIKey | COIMQXMWMXLUIR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.09 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |