C12H12ClF3N2O2 — CID 165482936
methyl 2-chloro-6-(2,2,2-trifluoroethyl)-7,8-dihydro-5H-1,6-naphthyridine-4-carboxylate (PubChem CID 165482936) has the molecular formula C12H12ClF3N2O2 and a molecular weight of 308.69 g/mol. Its IUPAC name is methyl 2-chloro-6-(2,2,2-trifluoroethyl)-7,8-dihydro-5H-1,6-naphthyridine-4-carboxylate.
| Compound Name | methyl 2-chloro-6-(2,2,2-trifluoroethyl)-7,8-dihydro-5H-1,6-naphthyridine-4-carboxylate |
|---|---|
| PubChem CID | 165482936 |
| Molecular Formula | C12H12ClF3N2O2 |
| Molecular Weight | 308.69 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | methyl 2-chloro-6-(2,2,2-trifluoroethyl)-7,8-dihydro-5H-1,6-naphthyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(Cl)nc2c1CN(CC(F)(F)F)CC2 |
| InChI | InChI=1S/C12H12ClF3N2O2/c1-20-11(19)7-4-10(13)17-9-2-3-18(5-8(7)9)6-12(14,15)16/h4H,2-3,5-6H2,1H3 |
| InChIKey | OWZOVRAIYGSRGS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.69 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|