C26H24ClNO5 — CID 16548560
(2-chlorophenyl) 2-(2-methoxyphenyl)-1-(4-methoxyphenyl)-6-oxopiperidine-3-carboxylate (PubChem CID 16548560) has the molecular formula C26H24ClNO5 and a molecular weight of 465.93 g/mol. Its IUPAC name is (2-chlorophenyl) 2-(2-methoxyphenyl)-1-(4-methoxyphenyl)-6-oxopiperidine-3-carboxylate.
| Compound Name | (2-chlorophenyl) 2-(2-methoxyphenyl)-1-(4-methoxyphenyl)-6-oxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 16548560 |
| Molecular Formula | C26H24ClNO5 |
| Molecular Weight | 465.93 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | (2-chlorophenyl) 2-(2-methoxyphenyl)-1-(4-methoxyphenyl)-6-oxopiperidine-3-carboxylate |
| SMILES | COc1ccc(N2C(=O)CCC(C(=O)Oc3ccccc3Cl)C2c2ccccc2OC)cc1 |
| InChI | InChI=1S/C26H24ClNO5/c1-31-18-13-11-17(12-14-18)28-24(29)16-15-20(25(28)19-7-3-5-9-22(19)32-2)26(30)33-23-10-6-4-8-21(23)27/h3-14,20,25H,15-16H2,1-2H3 |
| InChIKey | INJRCAOMPFTDMX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.93 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|