C26H23ClN2O6 — CID 16959488
(2-chloro-4-nitrophenyl) 2-(2-methoxyphenyl)-1-(4-methylphenyl)-6-oxopiperidine-3-carboxylate (PubChem CID 16959488) has the molecular formula C26H23ClN2O6 and a molecular weight of 494.93 g/mol. Its IUPAC name is (2-chloro-4-nitrophenyl) 2-(2-methoxyphenyl)-1-(4-methylphenyl)-6-oxopiperidine-3-carboxylate.
| Compound Name | (2-chloro-4-nitrophenyl) 2-(2-methoxyphenyl)-1-(4-methylphenyl)-6-oxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 16959488 |
| Molecular Formula | C26H23ClN2O6 |
| Molecular Weight | 494.93 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | (2-chloro-4-nitrophenyl) 2-(2-methoxyphenyl)-1-(4-methylphenyl)-6-oxopiperidine-3-carboxylate |
| SMILES | COc1ccccc1C1C(C(=O)Oc2ccc([N+](=O)[O-])cc2Cl)CCC(=O)N1c1ccc(C)cc1 |
| InChI | InChI=1S/C26H23ClN2O6/c1-16-7-9-17(10-8-16)28-24(30)14-12-20(25(28)19-5-3-4-6-22(19)34-2)26(31)35-23-13-11-18(29(32)33)15-21(23)27/h3-11,13,15,20,25H,12,14H2,1-2H3 |
| InChIKey | KLYJQZIGTCCBIZ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.93 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|