C26H24FN3O6 — CID 55363325
N-(2-fluoro-5-nitrophenyl)-2-(2-methoxyphenyl)-1-(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide (PubChem CID 55363325) has the molecular formula C26H24FN3O6 and a molecular weight of 493.49 g/mol. Its IUPAC name is N-(2-fluoro-5-nitrophenyl)-2-(2-methoxyphenyl)-1-(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | N-(2-fluoro-5-nitrophenyl)-2-(2-methoxyphenyl)-1-(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55363325 |
| Molecular Formula | C26H24FN3O6 |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | N-(2-fluoro-5-nitrophenyl)-2-(2-methoxyphenyl)-1-(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide |
| SMILES | COc1ccc(N2C(=O)CCC(C(=O)Nc3cc([N+](=O)[O-])ccc3F)C2c2ccccc2OC)cc1 |
| InChI | InChI=1S/C26H24FN3O6/c1-35-18-10-7-16(8-11-18)29-24(31)14-12-20(25(29)19-5-3-4-6-23(19)36-2)26(32)28-22-15-17(30(33)34)9-13-21(22)27/h3-11,13,15,20,25H,12,14H2,1-2H3,(H,28,32) |
| InChIKey | CFMQJDVMMBFDLT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|