C28H32N2O5 — CID 165485651
3-[[4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopent-2-ene-1-carbonyl]amino]-4,4-dimethylpentanoic acid (PubChem CID 165485651) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is 3-[[4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopent-2-ene-1-carbonyl]amino]-4,4-dimethylpentanoic acid.
| Compound Name | 3-[[4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopent-2-ene-1-carbonyl]amino]-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 165485651 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 3-[[4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopent-2-ene-1-carbonyl]amino]-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C)C(CC(=O)O)NC(=O)C1C=CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C1 |
| InChI | InChI=1S/C28H32N2O5/c1-28(2,3)24(15-25(31)32)30-26(33)17-12-13-18(14-17)29-27(34)35-16-23-21-10-6-4-8-19(21)20-9-5-7-11-22(20)23/h4-13,17-18,23-24H,14-16H2,1-3H3,(H,29,34)(H,30,33)(H,31,32) |
| InChIKey | TWVKDUWGAYFUBX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|